C13H11N3O2S — CID 110461136
N-(4-methoxy-1,3-benzothiazol-2-yl)-1H-pyrrole-2-carboxamide (PubChem CID 110461136) has the molecular formula C13H11N3O2S and a molecular weight of 273.32 g/mol. Its IUPAC name is N-(4-methoxy-1,3-benzothiazol-2-yl)-1H-pyrrole-2-carboxamide.
| Compound Name | N-(4-methoxy-1,3-benzothiazol-2-yl)-1H-pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 110461136 |
| Molecular Formula | C13H11N3O2S |
| Molecular Weight | 273.32 g/mol |
| Exact Mass | 273.06 |
| IUPAC Name | N-(4-methoxy-1,3-benzothiazol-2-yl)-1H-pyrrole-2-carboxamide |
| SMILES | COc1cccc2sc(NC(=O)c3ccc[nH]3)nc12 |
| InChI | InChI=1S/C13H11N3O2S/c1-18-9-5-2-6-10-11(9)15-13(19-10)16-12(17)8-4-3-7-14-8/h2-7,14H,1H3,(H,15,16,17) |
| InChIKey | BUBCQVWLFWESLB-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 67.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.32 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |