C15H10ClFN2OS — CID 7597144
N-(4-chloro-1,3-benzothiazol-2-yl)-2-(4-fluorophenyl)acetamide (PubChem CID 7597144) has the molecular formula C15H10ClFN2OS and a molecular weight of 320.78 g/mol. Its IUPAC name is N-(4-chloro-1,3-benzothiazol-2-yl)-2-(4-fluorophenyl)acetamide.
| Compound Name | N-(4-chloro-1,3-benzothiazol-2-yl)-2-(4-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 7597144 |
| Molecular Formula | C15H10ClFN2OS |
| Molecular Weight | 320.78 g/mol |
| Exact Mass | 320.02 |
| IUPAC Name | N-(4-chloro-1,3-benzothiazol-2-yl)-2-(4-fluorophenyl)acetamide |
| SMILES | O=C(Cc1ccc(F)cc1)Nc1nc2c(Cl)cccc2s1 |
| InChI | InChI=1S/C15H10ClFN2OS/c16-11-2-1-3-12-14(11)19-15(21-12)18-13(20)8-9-4-6-10(17)7-5-9/h1-7H,8H2,(H,18,19,20) |
| InChIKey | SWEOZWCZKCAHTR-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.78 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |