C15H10ClFN2O3S2 — CID 7544666
N-(4-chloro-1,3-benzothiazol-2-yl)-2-(4-fluorophenyl)sulfonylacetamide (PubChem CID 7544666) has the molecular formula C15H10ClFN2O3S2 and a molecular weight of 384.84 g/mol. Its IUPAC name is N-(4-chloro-1,3-benzothiazol-2-yl)-2-(4-fluorophenyl)sulfonylacetamide.
| Compound Name | N-(4-chloro-1,3-benzothiazol-2-yl)-2-(4-fluorophenyl)sulfonylacetamide |
|---|---|
| PubChem CID | 7544666 |
| Molecular Formula | C15H10ClFN2O3S2 |
| Molecular Weight | 384.84 g/mol |
| Exact Mass | 383.98 |
| IUPAC Name | N-(4-chloro-1,3-benzothiazol-2-yl)-2-(4-fluorophenyl)sulfonylacetamide |
| SMILES | O=C(CS(=O)(=O)c1ccc(F)cc1)Nc1nc2c(Cl)cccc2s1 |
| InChI | InChI=1S/C15H10ClFN2O3S2/c16-11-2-1-3-12-14(11)19-15(23-12)18-13(20)8-24(21,22)10-6-4-9(17)5-7-10/h1-7H,8H2,(H,18,19,20) |
| InChIKey | SZABZUFZZFROQB-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 76.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.84 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |