C15H11BrFN3O3S2 — CID 43953357
N'-(4-bromo-1,3-benzothiazol-2-yl)-2-(4-fluorophenyl)sulfonylacetohydrazide (PubChem CID 43953357) has the molecular formula C15H11BrFN3O3S2 and a molecular weight of 444.31 g/mol. Its IUPAC name is N'-(4-bromo-1,3-benzothiazol-2-yl)-2-(4-fluorophenyl)sulfonylacetohydrazide.
| Compound Name | N'-(4-bromo-1,3-benzothiazol-2-yl)-2-(4-fluorophenyl)sulfonylacetohydrazide |
|---|---|
| PubChem CID | 43953357 |
| Molecular Formula | C15H11BrFN3O3S2 |
| Molecular Weight | 444.31 g/mol |
| Exact Mass | 442.94 |
| IUPAC Name | N'-(4-bromo-1,3-benzothiazol-2-yl)-2-(4-fluorophenyl)sulfonylacetohydrazide |
| SMILES | O=C(CS(=O)(=O)c1ccc(F)cc1)NNc1nc2c(Br)cccc2s1 |
| InChI | InChI=1S/C15H11BrFN3O3S2/c16-11-2-1-3-12-14(11)18-15(24-12)20-19-13(21)8-25(22,23)10-6-4-9(17)5-7-10/h1-7H,8H2,(H,18,20)(H,19,21) |
| InChIKey | PZEVGNBKTOXEIJ-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.31 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|