C18H19N3O3S2 — CID 7600433
N'-(6-ethyl-1,3-benzothiazol-2-yl)-2-(4-methylphenyl)sulfonylacetohydrazide (PubChem CID 7600433) has the molecular formula C18H19N3O3S2 and a molecular weight of 389.50 g/mol. Its IUPAC name is N'-(6-ethyl-1,3-benzothiazol-2-yl)-2-(4-methylphenyl)sulfonylacetohydrazide.
| Compound Name | N'-(6-ethyl-1,3-benzothiazol-2-yl)-2-(4-methylphenyl)sulfonylacetohydrazide |
|---|---|
| PubChem CID | 7600433 |
| Molecular Formula | C18H19N3O3S2 |
| Molecular Weight | 389.50 g/mol |
| Exact Mass | 389.09 |
| IUPAC Name | N'-(6-ethyl-1,3-benzothiazol-2-yl)-2-(4-methylphenyl)sulfonylacetohydrazide |
| SMILES | CCc1ccc2nc(NNC(=O)CS(=O)(=O)c3ccc(C)cc3)sc2c1 |
| InChI | InChI=1S/C18H19N3O3S2/c1-3-13-6-9-15-16(10-13)25-18(19-15)21-20-17(22)11-26(23,24)14-7-4-12(2)5-8-14/h4-10H,3,11H2,1-2H3,(H,19,21)(H,20,22) |
| InChIKey | ZZJBEFDSOGNHAQ-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.50 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|