C17H15BrN2O3S2 — CID 41145741
N-(6-bromo-1,3-benzothiazol-2-yl)-2-(4-ethylsulfonylphenyl)acetamide (PubChem CID 41145741) has the molecular formula C17H15BrN2O3S2 and a molecular weight of 439.36 g/mol. Its IUPAC name is N-(6-bromo-1,3-benzothiazol-2-yl)-2-(4-ethylsulfonylphenyl)acetamide.
| Compound Name | N-(6-bromo-1,3-benzothiazol-2-yl)-2-(4-ethylsulfonylphenyl)acetamide |
|---|---|
| PubChem CID | 41145741 |
| Molecular Formula | C17H15BrN2O3S2 |
| Molecular Weight | 439.36 g/mol |
| Exact Mass | 437.97 |
| IUPAC Name | N-(6-bromo-1,3-benzothiazol-2-yl)-2-(4-ethylsulfonylphenyl)acetamide |
| SMILES | CCS(=O)(=O)c1ccc(CC(=O)Nc2nc3ccc(Br)cc3s2)cc1 |
| InChI | InChI=1S/C17H15BrN2O3S2/c1-2-25(22,23)13-6-3-11(4-7-13)9-16(21)20-17-19-14-8-5-12(18)10-15(14)24-17/h3-8,10H,2,9H2,1H3,(H,19,20,21) |
| InChIKey | VSHPCBVMKRANRK-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 76.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.36 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |