C20H22ClN3O3S2 — CID 43953452
N'-(6-butyl-1,3-benzothiazol-2-yl)-3-(4-chlorophenyl)sulfonylpropanehydrazide (PubChem CID 43953452) has the molecular formula C20H22ClN3O3S2 and a molecular weight of 452.00 g/mol. Its IUPAC name is N'-(6-butyl-1,3-benzothiazol-2-yl)-3-(4-chlorophenyl)sulfonylpropanehydrazide.
| Compound Name | N'-(6-butyl-1,3-benzothiazol-2-yl)-3-(4-chlorophenyl)sulfonylpropanehydrazide |
|---|---|
| PubChem CID | 43953452 |
| Molecular Formula | C20H22ClN3O3S2 |
| Molecular Weight | 452.00 g/mol |
| Exact Mass | 451.08 |
| IUPAC Name | N'-(6-butyl-1,3-benzothiazol-2-yl)-3-(4-chlorophenyl)sulfonylpropanehydrazide |
| SMILES | CCCCc1ccc2nc(NNC(=O)CCS(=O)(=O)c3ccc(Cl)cc3)sc2c1 |
| InChI | InChI=1S/C20H22ClN3O3S2/c1-2-3-4-14-5-10-17-18(13-14)28-20(22-17)24-23-19(25)11-12-29(26,27)16-8-6-15(21)7-9-16/h5-10,13H,2-4,11-12H2,1H3,(H,22,24)(H,23,25) |
| InChIKey | XQPPFEFCCXXOAI-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.00 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|