C17H15Cl2N3O3S2 — CID 43953418
N'-(5-chloro-4-methyl-1,3-benzothiazol-2-yl)-3-(4-chlorophenyl)sulfonylpropanehydrazide (PubChem CID 43953418) has the molecular formula C17H15Cl2N3O3S2 and a molecular weight of 444.37 g/mol. Its IUPAC name is N'-(5-chloro-4-methyl-1,3-benzothiazol-2-yl)-3-(4-chlorophenyl)sulfonylpropanehydrazide.
| Compound Name | N'-(5-chloro-4-methyl-1,3-benzothiazol-2-yl)-3-(4-chlorophenyl)sulfonylpropanehydrazide |
|---|---|
| PubChem CID | 43953418 |
| Molecular Formula | C17H15Cl2N3O3S2 |
| Molecular Weight | 444.37 g/mol |
| Exact Mass | 442.99 |
| IUPAC Name | N'-(5-chloro-4-methyl-1,3-benzothiazol-2-yl)-3-(4-chlorophenyl)sulfonylpropanehydrazide |
| SMILES | Cc1c(Cl)ccc2sc(NNC(=O)CCS(=O)(=O)c3ccc(Cl)cc3)nc12 |
| InChI | InChI=1S/C17H15Cl2N3O3S2/c1-10-13(19)6-7-14-16(10)20-17(26-14)22-21-15(23)8-9-27(24,25)12-4-2-11(18)3-5-12/h2-7H,8-9H2,1H3,(H,20,22)(H,21,23) |
| InChIKey | VWJZRPTWKULEKG-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.37 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|