C19H19ClN2O3S2 — CID 41319706
4-(4-chlorophenyl)sulfonyl-N-(4,5-dimethyl-1,3-benzothiazol-2-yl)butanamide (PubChem CID 41319706) has the molecular formula C19H19ClN2O3S2 and a molecular weight of 422.96 g/mol. Its IUPAC name is 4-(4-chlorophenyl)sulfonyl-N-(4,5-dimethyl-1,3-benzothiazol-2-yl)butanamide.
| Compound Name | 4-(4-chlorophenyl)sulfonyl-N-(4,5-dimethyl-1,3-benzothiazol-2-yl)butanamide |
|---|---|
| PubChem CID | 41319706 |
| Molecular Formula | C19H19ClN2O3S2 |
| Molecular Weight | 422.96 g/mol |
| Exact Mass | 422.05 |
| IUPAC Name | 4-(4-chlorophenyl)sulfonyl-N-(4,5-dimethyl-1,3-benzothiazol-2-yl)butanamide |
| SMILES | Cc1ccc2sc(NC(=O)CCCS(=O)(=O)c3ccc(Cl)cc3)nc2c1C |
| InChI | InChI=1S/C19H19ClN2O3S2/c1-12-5-10-16-18(13(12)2)22-19(26-16)21-17(23)4-3-11-27(24,25)15-8-6-14(20)7-9-15/h5-10H,3-4,11H2,1-2H3,(H,21,22,23) |
| InChIKey | VFYSYLPYSQMLTC-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 76.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.96 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |