C15H10ClF2N3O3S2 — CID 43953398
2-(4-chlorophenyl)sulfonyl-N'-(4,6-difluoro-1,3-benzothiazol-2-yl)acetohydrazide (PubChem CID 43953398) has the molecular formula C15H10ClF2N3O3S2 and a molecular weight of 417.85 g/mol. Its IUPAC name is 2-(4-chlorophenyl)sulfonyl-N'-(4,6-difluoro-1,3-benzothiazol-2-yl)acetohydrazide.
| Compound Name | 2-(4-chlorophenyl)sulfonyl-N'-(4,6-difluoro-1,3-benzothiazol-2-yl)acetohydrazide |
|---|---|
| PubChem CID | 43953398 |
| Molecular Formula | C15H10ClF2N3O3S2 |
| Molecular Weight | 417.85 g/mol |
| Exact Mass | 416.98 |
| IUPAC Name | 2-(4-chlorophenyl)sulfonyl-N'-(4,6-difluoro-1,3-benzothiazol-2-yl)acetohydrazide |
| SMILES | O=C(CS(=O)(=O)c1ccc(Cl)cc1)NNc1nc2c(F)cc(F)cc2s1 |
| InChI | InChI=1S/C15H10ClF2N3O3S2/c16-8-1-3-10(4-2-8)26(23,24)7-13(22)20-21-15-19-14-11(18)5-9(17)6-12(14)25-15/h1-6H,7H2,(H,19,21)(H,20,22) |
| InChIKey | BEERVDIVROGBDG-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.85 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|