C23H18F2N4O3S2 — CID 16814085
N'-(4,6-difluoro-1,3-benzothiazol-2-yl)-4-(3,4-dihydro-1H-isoquinolin-2-ylsulfonyl)benzohydrazide (PubChem CID 16814085) has the molecular formula C23H18F2N4O3S2 and a molecular weight of 500.55 g/mol. Its IUPAC name is N'-(4,6-difluoro-1,3-benzothiazol-2-yl)-4-(3,4-dihydro-1H-isoquinolin-2-ylsulfonyl)benzohydrazide.
| Compound Name | N'-(4,6-difluoro-1,3-benzothiazol-2-yl)-4-(3,4-dihydro-1H-isoquinolin-2-ylsulfonyl)benzohydrazide |
|---|---|
| PubChem CID | 16814085 |
| Molecular Formula | C23H18F2N4O3S2 |
| Molecular Weight | 500.55 g/mol |
| Exact Mass | 500.08 |
| IUPAC Name | N'-(4,6-difluoro-1,3-benzothiazol-2-yl)-4-(3,4-dihydro-1H-isoquinolin-2-ylsulfonyl)benzohydrazide |
| SMILES | O=C(NNc1nc2c(F)cc(F)cc2s1)c1ccc(S(=O)(=O)N2CCc3ccccc3C2)cc1 |
| InChI | InChI=1S/C23H18F2N4O3S2/c24-17-11-19(25)21-20(12-17)33-23(26-21)28-27-22(30)15-5-7-18(8-6-15)34(31,32)29-10-9-14-3-1-2-4-16(14)13-29/h1-8,11-12H,9-10,13H2,(H,26,28)(H,27,30) |
| InChIKey | DTAIMTCHWMJYOB-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.55 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|