C15H11F2N3O3S2 — CID 7600080
N'-(4,6-difluoro-1,3-benzothiazol-2-yl)-2-methylsulfonylbenzohydrazide (PubChem CID 7600080) has the molecular formula C15H11F2N3O3S2 and a molecular weight of 383.40 g/mol. Its IUPAC name is N'-(4,6-difluoro-1,3-benzothiazol-2-yl)-2-methylsulfonylbenzohydrazide.
| Compound Name | N'-(4,6-difluoro-1,3-benzothiazol-2-yl)-2-methylsulfonylbenzohydrazide |
|---|---|
| PubChem CID | 7600080 |
| Molecular Formula | C15H11F2N3O3S2 |
| Molecular Weight | 383.40 g/mol |
| Exact Mass | 383.02 |
| IUPAC Name | N'-(4,6-difluoro-1,3-benzothiazol-2-yl)-2-methylsulfonylbenzohydrazide |
| SMILES | CS(=O)(=O)c1ccccc1C(=O)NNc1nc2c(F)cc(F)cc2s1 |
| InChI | InChI=1S/C15H11F2N3O3S2/c1-25(22,23)12-5-3-2-4-9(12)14(21)19-20-15-18-13-10(17)6-8(16)7-11(13)24-15/h2-7H,1H3,(H,18,20)(H,19,21) |
| InChIKey | PEMWIPVZDPXOHX-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.40 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|