C20H20F2N4O4S2 — CID 41043783
N'-(4,6-difluoro-1,3-benzothiazol-2-yl)-4-[(2S,6S)-2,6-dimethylmorpholin-4-yl]sulfonylbenzohydrazide (PubChem CID 41043783) has the molecular formula C20H20F2N4O4S2 and a molecular weight of 482.53 g/mol. Its IUPAC name is N'-(4,6-difluoro-1,3-benzothiazol-2-yl)-4-[(2S,6S)-2,6-dimethylmorpholin-4-yl]sulfonylbenzohydrazide.
| Compound Name | N'-(4,6-difluoro-1,3-benzothiazol-2-yl)-4-[(2S,6S)-2,6-dimethylmorpholin-4-yl]sulfonylbenzohydrazide |
|---|---|
| PubChem CID | 41043783 |
| Molecular Formula | C20H20F2N4O4S2 |
| Molecular Weight | 482.53 g/mol |
| Exact Mass | 482.09 |
| IUPAC Name | N'-(4,6-difluoro-1,3-benzothiazol-2-yl)-4-[(2S,6S)-2,6-dimethylmorpholin-4-yl]sulfonylbenzohydrazide |
| SMILES | C[C@H]1CN(S(=O)(=O)c2ccc(C(=O)NNc3nc4c(F)cc(F)cc4s3)cc2)C[C@H](C)O1 |
| InChI | InChI=1S/C20H20F2N4O4S2/c1-11-9-26(10-12(2)30-11)32(28,29)15-5-3-13(4-6-15)19(27)24-25-20-23-18-16(22)7-14(21)8-17(18)31-20/h3-8,11-12H,9-10H2,1-2H3,(H,23,25)(H,24,27)/t11-,12-/m0/s1 |
| InChIKey | GZLDDTXGSKKFPL-RYUDHWBXSA-N |
| XLogP | 3.13 |
| TPSA | 100.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.53 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|