C17H17N3OS2 — CID 7600331
N'-(4,6-dimethyl-1,3-benzothiazol-2-yl)-2-methylsulfanylbenzohydrazide (PubChem CID 7600331) has the molecular formula C17H17N3OS2 and a molecular weight of 343.48 g/mol. Its IUPAC name is N'-(4,6-dimethyl-1,3-benzothiazol-2-yl)-2-methylsulfanylbenzohydrazide.
| Compound Name | N'-(4,6-dimethyl-1,3-benzothiazol-2-yl)-2-methylsulfanylbenzohydrazide |
|---|---|
| PubChem CID | 7600331 |
| Molecular Formula | C17H17N3OS2 |
| Molecular Weight | 343.48 g/mol |
| Exact Mass | 343.08 |
| IUPAC Name | N'-(4,6-dimethyl-1,3-benzothiazol-2-yl)-2-methylsulfanylbenzohydrazide |
| SMILES | CSc1ccccc1C(=O)NNc1nc2c(C)cc(C)cc2s1 |
| InChI | InChI=1S/C17H17N3OS2/c1-10-8-11(2)15-14(9-10)23-17(18-15)20-19-16(21)12-6-4-5-7-13(12)22-3/h4-9H,1-3H3,(H,18,20)(H,19,21) |
| InChIKey | GZYVXJRKSWPKAO-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.48 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|