C17H14N4OS2 — CID 7105678
N'-(5,7-dimethyl-1,3-benzothiazol-2-yl)-1,3-benzothiazole-2-carbohydrazide (PubChem CID 7105678) has the molecular formula C17H14N4OS2 and a molecular weight of 354.46 g/mol. Its IUPAC name is N'-(5,7-dimethyl-1,3-benzothiazol-2-yl)-1,3-benzothiazole-2-carbohydrazide.
| Compound Name | N'-(5,7-dimethyl-1,3-benzothiazol-2-yl)-1,3-benzothiazole-2-carbohydrazide |
|---|---|
| PubChem CID | 7105678 |
| Molecular Formula | C17H14N4OS2 |
| Molecular Weight | 354.46 g/mol |
| Exact Mass | 354.06 |
| IUPAC Name | N'-(5,7-dimethyl-1,3-benzothiazol-2-yl)-1,3-benzothiazole-2-carbohydrazide |
| SMILES | Cc1cc(C)c2sc(NNC(=O)c3nc4ccccc4s3)nc2c1 |
| InChI | InChI=1S/C17H14N4OS2/c1-9-7-10(2)14-12(8-9)19-17(24-14)21-20-15(22)16-18-11-5-3-4-6-13(11)23-16/h3-8H,1-2H3,(H,19,21)(H,20,22) |
| InChIKey | VODQWLPEYXCSBE-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.46 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|