C14H13N3OS2 — CID 43953231
N'-(5,7-dimethyl-1,3-benzothiazol-2-yl)thiophene-2-carbohydrazide (PubChem CID 43953231) has the molecular formula C14H13N3OS2 and a molecular weight of 303.41 g/mol. Its IUPAC name is N'-(5,7-dimethyl-1,3-benzothiazol-2-yl)thiophene-2-carbohydrazide.
| Compound Name | N'-(5,7-dimethyl-1,3-benzothiazol-2-yl)thiophene-2-carbohydrazide |
|---|---|
| PubChem CID | 43953231 |
| Molecular Formula | C14H13N3OS2 |
| Molecular Weight | 303.41 g/mol |
| Exact Mass | 303.05 |
| IUPAC Name | N'-(5,7-dimethyl-1,3-benzothiazol-2-yl)thiophene-2-carbohydrazide |
| SMILES | Cc1cc(C)c2sc(NNC(=O)c3cccs3)nc2c1 |
| InChI | InChI=1S/C14H13N3OS2/c1-8-6-9(2)12-10(7-8)15-14(20-12)17-16-13(18)11-4-3-5-19-11/h3-7H,1-2H3,(H,15,17)(H,16,18) |
| InChIKey | BZZSSJOBFWZQCM-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.41 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|