C12H8ClN3OS2 — CID 43953203
N'-(6-chloro-1,3-benzothiazol-2-yl)thiophene-2-carbohydrazide (PubChem CID 43953203) has the molecular formula C12H8ClN3OS2 and a molecular weight of 309.80 g/mol. Its IUPAC name is N'-(6-chloro-1,3-benzothiazol-2-yl)thiophene-2-carbohydrazide.
| Compound Name | N'-(6-chloro-1,3-benzothiazol-2-yl)thiophene-2-carbohydrazide |
|---|---|
| PubChem CID | 43953203 |
| Molecular Formula | C12H8ClN3OS2 |
| Molecular Weight | 309.80 g/mol |
| Exact Mass | 308.98 |
| IUPAC Name | N'-(6-chloro-1,3-benzothiazol-2-yl)thiophene-2-carbohydrazide |
| SMILES | O=C(NNc1nc2ccc(Cl)cc2s1)c1cccs1 |
| InChI | InChI=1S/C12H8ClN3OS2/c13-7-3-4-8-10(6-7)19-12(14-8)16-15-11(17)9-2-1-5-18-9/h1-6H,(H,14,16)(H,15,17) |
| InChIKey | PYSGVEFOPIFICG-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.80 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|