C16H14ClN3O3S — CID 7600552
N'-(6-chloro-1,3-benzothiazol-2-yl)-2,3-dimethoxybenzohydrazide (PubChem CID 7600552) has the molecular formula C16H14ClN3O3S and a molecular weight of 363.83 g/mol. Its IUPAC name is N'-(6-chloro-1,3-benzothiazol-2-yl)-2,3-dimethoxybenzohydrazide.
| Compound Name | N'-(6-chloro-1,3-benzothiazol-2-yl)-2,3-dimethoxybenzohydrazide |
|---|---|
| PubChem CID | 7600552 |
| Molecular Formula | C16H14ClN3O3S |
| Molecular Weight | 363.83 g/mol |
| Exact Mass | 363.04 |
| IUPAC Name | N'-(6-chloro-1,3-benzothiazol-2-yl)-2,3-dimethoxybenzohydrazide |
| SMILES | COc1cccc(C(=O)NNc2nc3ccc(Cl)cc3s2)c1OC |
| InChI | InChI=1S/C16H14ClN3O3S/c1-22-12-5-3-4-10(14(12)23-2)15(21)19-20-16-18-11-7-6-9(17)8-13(11)24-16/h3-8H,1-2H3,(H,18,20)(H,19,21) |
| InChIKey | KEECINNWAUZEKG-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 72.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.83 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|