C17H14ClN3O6S — CID 55414055
N-(6-chloro-1,3-benzothiazol-2-yl)-3,4,5-trimethoxy-2-nitrobenzamide (PubChem CID 55414055) has the molecular formula C17H14ClN3O6S and a molecular weight of 423.83 g/mol. Its IUPAC name is N-(6-chloro-1,3-benzothiazol-2-yl)-3,4,5-trimethoxy-2-nitrobenzamide.
| Compound Name | N-(6-chloro-1,3-benzothiazol-2-yl)-3,4,5-trimethoxy-2-nitrobenzamide |
|---|---|
| PubChem CID | 55414055 |
| Molecular Formula | C17H14ClN3O6S |
| Molecular Weight | 423.83 g/mol |
| Exact Mass | 423.03 |
| IUPAC Name | N-(6-chloro-1,3-benzothiazol-2-yl)-3,4,5-trimethoxy-2-nitrobenzamide |
| SMILES | COc1cc(C(=O)Nc2nc3ccc(Cl)cc3s2)c([N+](=O)[O-])c(OC)c1OC |
| InChI | InChI=1S/C17H14ClN3O6S/c1-25-11-7-9(13(21(23)24)15(27-3)14(11)26-2)16(22)20-17-19-10-5-4-8(18)6-12(10)28-17/h4-7H,1-3H3,(H,19,20,22) |
| InChIKey | KHZFCKMEOVHJRG-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 112.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.83 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|