C20H18FN3O7S — CID 55414517
N-[4-(3-fluoro-4-methoxyphenyl)-1,3-thiazol-2-yl]-3,4,5-trimethoxy-2-nitrobenzamide (PubChem CID 55414517) has the molecular formula C20H18FN3O7S and a molecular weight of 463.44 g/mol. Its IUPAC name is N-[4-(3-fluoro-4-methoxyphenyl)-1,3-thiazol-2-yl]-3,4,5-trimethoxy-2-nitrobenzamide.
| Compound Name | N-[4-(3-fluoro-4-methoxyphenyl)-1,3-thiazol-2-yl]-3,4,5-trimethoxy-2-nitrobenzamide |
|---|---|
| PubChem CID | 55414517 |
| Molecular Formula | C20H18FN3O7S |
| Molecular Weight | 463.44 g/mol |
| Exact Mass | 463.08 |
| IUPAC Name | N-[4-(3-fluoro-4-methoxyphenyl)-1,3-thiazol-2-yl]-3,4,5-trimethoxy-2-nitrobenzamide |
| SMILES | COc1ccc(-c2csc(NC(=O)c3cc(OC)c(OC)c(OC)c3[N+](=O)[O-])n2)cc1F |
| InChI | InChI=1S/C20H18FN3O7S/c1-28-14-6-5-10(7-12(14)21)13-9-32-20(22-13)23-19(25)11-8-15(29-2)17(30-3)18(31-4)16(11)24(26)27/h5-9H,1-4H3,(H,22,23,25) |
| InChIKey | MWNOBZBZBZRCCS-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 122.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.44 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|