C19H17FN4O4S — CID 16962942
N-[4-(3-fluoro-4-methoxyphenyl)-1,3-thiazol-2-yl]-3-(2-nitroanilino)propanamide (PubChem CID 16962942) has the molecular formula C19H17FN4O4S and a molecular weight of 416.43 g/mol. Its IUPAC name is N-[4-(3-fluoro-4-methoxyphenyl)-1,3-thiazol-2-yl]-3-(2-nitroanilino)propanamide.
| Compound Name | N-[4-(3-fluoro-4-methoxyphenyl)-1,3-thiazol-2-yl]-3-(2-nitroanilino)propanamide |
|---|---|
| PubChem CID | 16962942 |
| Molecular Formula | C19H17FN4O4S |
| Molecular Weight | 416.43 g/mol |
| Exact Mass | 416.10 |
| IUPAC Name | N-[4-(3-fluoro-4-methoxyphenyl)-1,3-thiazol-2-yl]-3-(2-nitroanilino)propanamide |
| SMILES | COc1ccc(-c2csc(NC(=O)CCNc3ccccc3[N+](=O)[O-])n2)cc1F |
| InChI | InChI=1S/C19H17FN4O4S/c1-28-17-7-6-12(10-13(17)20)15-11-29-19(22-15)23-18(25)8-9-21-14-4-2-3-5-16(14)24(26)27/h2-7,10-11,21H,8-9H2,1H3,(H,22,23,25) |
| InChIKey | YZJKKEVCUVINJU-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 106.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.43 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|