C20H21N5O5S2 — CID 16962930
N-[4-[4-[methyl(methylsulfonyl)amino]phenyl]-1,3-thiazol-2-yl]-3-(2-nitroanilino)propanamide (PubChem CID 16962930) has the molecular formula C20H21N5O5S2 and a molecular weight of 475.55 g/mol. Its IUPAC name is N-[4-[4-[methyl(methylsulfonyl)amino]phenyl]-1,3-thiazol-2-yl]-3-(2-nitroanilino)propanamide.
| Compound Name | N-[4-[4-[methyl(methylsulfonyl)amino]phenyl]-1,3-thiazol-2-yl]-3-(2-nitroanilino)propanamide |
|---|---|
| PubChem CID | 16962930 |
| Molecular Formula | C20H21N5O5S2 |
| Molecular Weight | 475.55 g/mol |
| Exact Mass | 475.10 |
| IUPAC Name | N-[4-[4-[methyl(methylsulfonyl)amino]phenyl]-1,3-thiazol-2-yl]-3-(2-nitroanilino)propanamide |
| SMILES | CN(c1ccc(-c2csc(NC(=O)CCNc3ccccc3[N+](=O)[O-])n2)cc1)S(C)(=O)=O |
| InChI | InChI=1S/C20H21N5O5S2/c1-24(32(2,29)30)15-9-7-14(8-10-15)17-13-31-20(22-17)23-19(26)11-12-21-16-5-3-4-6-18(16)25(27)28/h3-10,13,21H,11-12H2,1-2H3,(H,22,23,26) |
| InChIKey | XNICEPNHEYUWQP-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 134.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.55 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|