C11H8BrN3O3S — CID 10450021
2-bromo-N-[4-(2-nitrophenyl)-1,3-thiazol-2-yl]acetamide (PubChem CID 10450021) has the molecular formula C11H8BrN3O3S and a molecular weight of 342.17 g/mol. Its IUPAC name is 2-bromo-N-[4-(2-nitrophenyl)-1,3-thiazol-2-yl]acetamide.
| Compound Name | 2-bromo-N-[4-(2-nitrophenyl)-1,3-thiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 10450021 |
| Molecular Formula | C11H8BrN3O3S |
| Molecular Weight | 342.17 g/mol |
| Exact Mass | 340.95 |
| IUPAC Name | 2-bromo-N-[4-(2-nitrophenyl)-1,3-thiazol-2-yl]acetamide |
| SMILES | O=C(CBr)Nc1nc(-c2ccccc2[N+](=O)[O-])cs1 |
| InChI | InChI=1S/C11H8BrN3O3S/c12-5-10(16)14-11-13-8(6-19-11)7-3-1-2-4-9(7)15(17)18/h1-4,6H,5H2,(H,13,14,16) |
| InChIKey | NAAFZNFUPZEBDK-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 85.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.17 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|