C17H12ClN3O3S — CID 42992045
N-[4-(2-chlorophenyl)-1,3-thiazol-2-yl]-2-(4-nitrophenyl)acetamide (PubChem CID 42992045) has the molecular formula C17H12ClN3O3S and a molecular weight of 373.82 g/mol. Its IUPAC name is N-[4-(2-chlorophenyl)-1,3-thiazol-2-yl]-2-(4-nitrophenyl)acetamide.
| Compound Name | N-[4-(2-chlorophenyl)-1,3-thiazol-2-yl]-2-(4-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 42992045 |
| Molecular Formula | C17H12ClN3O3S |
| Molecular Weight | 373.82 g/mol |
| Exact Mass | 373.03 |
| IUPAC Name | N-[4-(2-chlorophenyl)-1,3-thiazol-2-yl]-2-(4-nitrophenyl)acetamide |
| SMILES | O=C(Cc1ccc([N+](=O)[O-])cc1)Nc1nc(-c2ccccc2Cl)cs1 |
| InChI | InChI=1S/C17H12ClN3O3S/c18-14-4-2-1-3-13(14)15-10-25-17(19-15)20-16(22)9-11-5-7-12(8-6-11)21(23)24/h1-8,10H,9H2,(H,19,20,22) |
| InChIKey | RRXLAXDKWLDSQZ-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 85.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.82 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|