C20H14N4O3S2 — CID 118986380
N-[4-(4-nitrophenyl)-1,3-thiazol-2-yl]-2-(2-phenyl-1,3-thiazol-4-yl)acetamide (PubChem CID 118986380) has the molecular formula C20H14N4O3S2 and a molecular weight of 422.49 g/mol. Its IUPAC name is N-[4-(4-nitrophenyl)-1,3-thiazol-2-yl]-2-(2-phenyl-1,3-thiazol-4-yl)acetamide.
| Compound Name | N-[4-(4-nitrophenyl)-1,3-thiazol-2-yl]-2-(2-phenyl-1,3-thiazol-4-yl)acetamide |
|---|---|
| PubChem CID | 118986380 |
| Molecular Formula | C20H14N4O3S2 |
| Molecular Weight | 422.49 g/mol |
| Exact Mass | 422.05 |
| IUPAC Name | N-[4-(4-nitrophenyl)-1,3-thiazol-2-yl]-2-(2-phenyl-1,3-thiazol-4-yl)acetamide |
| SMILES | O=C(Cc1csc(-c2ccccc2)n1)Nc1nc(-c2ccc([N+](=O)[O-])cc2)cs1 |
| InChI | InChI=1S/C20H14N4O3S2/c25-18(10-15-11-28-19(21-15)14-4-2-1-3-5-14)23-20-22-17(12-29-20)13-6-8-16(9-7-13)24(26)27/h1-9,11-12H,10H2,(H,22,23,25) |
| InChIKey | IWMOLJCNFUBBIK-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 98.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.49 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|