C18H13ClN4O4S — CID 84550703
N-(2-chloro-4-nitrophenyl)-2-[(2-phenylacetyl)amino]-1,3-thiazole-4-carboxamide (PubChem CID 84550703) has the molecular formula C18H13ClN4O4S and a molecular weight of 416.85 g/mol. Its IUPAC name is N-(2-chloro-4-nitrophenyl)-2-[(2-phenylacetyl)amino]-1,3-thiazole-4-carboxamide.
| Compound Name | N-(2-chloro-4-nitrophenyl)-2-[(2-phenylacetyl)amino]-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 84550703 |
| Molecular Formula | C18H13ClN4O4S |
| Molecular Weight | 416.85 g/mol |
| Exact Mass | 416.03 |
| IUPAC Name | N-(2-chloro-4-nitrophenyl)-2-[(2-phenylacetyl)amino]-1,3-thiazole-4-carboxamide |
| SMILES | O=C(Cc1ccccc1)Nc1nc(C(=O)Nc2ccc([N+](=O)[O-])cc2Cl)cs1 |
| InChI | InChI=1S/C18H13ClN4O4S/c19-13-9-12(23(26)27)6-7-14(13)20-17(25)15-10-28-18(21-15)22-16(24)8-11-4-2-1-3-5-11/h1-7,9-10H,8H2,(H,20,25)(H,21,22,24) |
| InChIKey | QQTIUDPSWDSNMQ-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 114.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.85 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|