C19H15ClN4O4S — CID 84550916
N-(2-chloro-4-nitrophenyl)-2-(3-phenylpropanoylamino)-1,3-thiazole-4-carboxamide (PubChem CID 84550916) has the molecular formula C19H15ClN4O4S and a molecular weight of 430.87 g/mol. Its IUPAC name is N-(2-chloro-4-nitrophenyl)-2-(3-phenylpropanoylamino)-1,3-thiazole-4-carboxamide.
| Compound Name | N-(2-chloro-4-nitrophenyl)-2-(3-phenylpropanoylamino)-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 84550916 |
| Molecular Formula | C19H15ClN4O4S |
| Molecular Weight | 430.87 g/mol |
| Exact Mass | 430.05 |
| IUPAC Name | N-(2-chloro-4-nitrophenyl)-2-(3-phenylpropanoylamino)-1,3-thiazole-4-carboxamide |
| SMILES | O=C(CCc1ccccc1)Nc1nc(C(=O)Nc2ccc([N+](=O)[O-])cc2Cl)cs1 |
| InChI | InChI=1S/C19H15ClN4O4S/c20-14-10-13(24(27)28)7-8-15(14)21-18(26)16-11-29-19(22-16)23-17(25)9-6-12-4-2-1-3-5-12/h1-5,7-8,10-11H,6,9H2,(H,21,26)(H,22,23,25) |
| InChIKey | CADDWQOFRUMHEN-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 114.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.87 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|