C17H13ClN2O2S — CID 78838502
N-[4-(2-chlorophenyl)-1,3-thiazol-2-yl]-2-(4-hydroxyphenyl)acetamide (PubChem CID 78838502) has the molecular formula C17H13ClN2O2S and a molecular weight of 344.82 g/mol. Its IUPAC name is N-[4-(2-chlorophenyl)-1,3-thiazol-2-yl]-2-(4-hydroxyphenyl)acetamide.
| Compound Name | N-[4-(2-chlorophenyl)-1,3-thiazol-2-yl]-2-(4-hydroxyphenyl)acetamide |
|---|---|
| PubChem CID | 78838502 |
| Molecular Formula | C17H13ClN2O2S |
| Molecular Weight | 344.82 g/mol |
| Exact Mass | 344.04 |
| IUPAC Name | N-[4-(2-chlorophenyl)-1,3-thiazol-2-yl]-2-(4-hydroxyphenyl)acetamide |
| SMILES | O=C(Cc1ccc(O)cc1)Nc1nc(-c2ccccc2Cl)cs1 |
| InChI | InChI=1S/C17H13ClN2O2S/c18-14-4-2-1-3-13(14)15-10-23-17(19-15)20-16(22)9-11-5-7-12(21)8-6-11/h1-8,10,21H,9H2,(H,19,20,22) |
| InChIKey | WLCZPUKMEHKWSM-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.82 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |