C16H20ClN3OS — CID 119676852
7-amino-N-[4-(2-chlorophenyl)-1,3-thiazol-2-yl]heptanamide (PubChem CID 119676852) has the molecular formula C16H20ClN3OS and a molecular weight of 337.88 g/mol. Its IUPAC name is 7-amino-N-[4-(2-chlorophenyl)-1,3-thiazol-2-yl]heptanamide.
| Compound Name | 7-amino-N-[4-(2-chlorophenyl)-1,3-thiazol-2-yl]heptanamide |
|---|---|
| PubChem CID | 119676852 |
| Molecular Formula | C16H20ClN3OS |
| Molecular Weight | 337.88 g/mol |
| Exact Mass | 337.10 |
| IUPAC Name | 7-amino-N-[4-(2-chlorophenyl)-1,3-thiazol-2-yl]heptanamide |
| SMILES | NCCCCCCC(=O)Nc1nc(-c2ccccc2Cl)cs1 |
| InChI | InChI=1S/C16H20ClN3OS/c17-13-8-5-4-7-12(13)14-11-22-16(19-14)20-15(21)9-3-1-2-6-10-18/h4-5,7-8,11H,1-3,6,9-10,18H2,(H,19,20,21) |
| InChIKey | SJPLEVWNKDSQIY-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.88 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|