C15H22ClN3OS2 — CID 119689440
7-amino-N-[4-(5-methylthiophen-2-yl)-1,3-thiazol-2-yl]heptanamide;hydrochloride (PubChem CID 119689440) has the molecular formula C15H22ClN3OS2 and a molecular weight of 359.95 g/mol. Its IUPAC name is 7-amino-N-[4-(5-methylthiophen-2-yl)-1,3-thiazol-2-yl]heptanamide;hydrochloride.
| Compound Name | 7-amino-N-[4-(5-methylthiophen-2-yl)-1,3-thiazol-2-yl]heptanamide;hydrochloride |
|---|---|
| PubChem CID | 119689440 |
| Molecular Formula | C15H22ClN3OS2 |
| Molecular Weight | 359.95 g/mol |
| Exact Mass | 359.09 |
| IUPAC Name | 7-amino-N-[4-(5-methylthiophen-2-yl)-1,3-thiazol-2-yl]heptanamide;hydrochloride |
| SMILES | Cc1ccc(-c2csc(NC(=O)CCCCCCN)n2)s1.Cl |
| InChI | InChI=1S/C15H21N3OS2.ClH/c1-11-7-8-13(21-11)12-10-20-15(17-12)18-14(19)6-4-2-3-5-9-16;/h7-8,10H,2-6,9,16H2,1H3,(H,17,18,19);1H |
| InChIKey | LLUWUUUQNMQICZ-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.95 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|