C19H25N5O4S — CID 25030885
N-[4-[2-[(2-aminoacetyl)amino]phenyl]-1,3-thiazol-2-yl]-N'-hydroxyoctanediamide (PubChem CID 25030885) has the molecular formula C19H25N5O4S and a molecular weight of 419.51 g/mol. Its IUPAC name is N-[4-[2-[(2-aminoacetyl)amino]phenyl]-1,3-thiazol-2-yl]-N'-hydroxyoctanediamide.
| Compound Name | N-[4-[2-[(2-aminoacetyl)amino]phenyl]-1,3-thiazol-2-yl]-N'-hydroxyoctanediamide |
|---|---|
| PubChem CID | 25030885 |
| Molecular Formula | C19H25N5O4S |
| Molecular Weight | 419.51 g/mol |
| Exact Mass | 419.16 |
| IUPAC Name | N-[4-[2-[(2-aminoacetyl)amino]phenyl]-1,3-thiazol-2-yl]-N'-hydroxyoctanediamide |
| SMILES | NCC(=O)Nc1ccccc1-c1csc(NC(=O)CCCCCCC(=O)NO)n1 |
| InChI | InChI=1S/C19H25N5O4S/c20-11-18(27)21-14-8-6-5-7-13(14)15-12-29-19(22-15)23-16(25)9-3-1-2-4-10-17(26)24-28/h5-8,12,28H,1-4,9-11,20H2,(H,21,27)(H,24,26)(H,22,23,25) |
| InChIKey | XRXCBYSTWFHSCC-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 146.44 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.51 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|