C15H23N3O3 — CID 143322146
N-[2-(aminomethyl)phenyl]-N'-hydroxyoctanediamide (PubChem CID 143322146) has the molecular formula C15H23N3O3 and a molecular weight of 293.37 g/mol. Its IUPAC name is N-[2-(aminomethyl)phenyl]-N'-hydroxyoctanediamide.
| Compound Name | N-[2-(aminomethyl)phenyl]-N'-hydroxyoctanediamide |
|---|---|
| PubChem CID | 143322146 |
| Molecular Formula | C15H23N3O3 |
| Molecular Weight | 293.37 g/mol |
| Exact Mass | 293.17 |
| IUPAC Name | N-[2-(aminomethyl)phenyl]-N'-hydroxyoctanediamide |
| SMILES | NCc1ccccc1NC(=O)CCCCCCC(=O)NO |
| InChI | InChI=1S/C15H23N3O3/c16-11-12-7-5-6-8-13(12)17-14(19)9-3-1-2-4-10-15(20)18-21/h5-8,21H,1-4,9-11,16H2,(H,17,19)(H,18,20) |
| InChIKey | OSCFWKMFCALRAJ-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 104.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.37 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|