N-[2-(aminomethyl)phenyl]carbamoyl chloride

C8H9ClN2O — CID 142823786

IUPACN-[2-(aminomethyl)phenyl]carbamoyl chloride
SMILESNCc1ccccc1NC(=O)Cl
InChIInChI=1S/C8H9ClN2O/c9-8(12)11-7-4-2-1-3-6(7)5-10/h1-4H,5,10H2,(H,11,12)
InChIKeyMBOJXXDPSZZTOK-UHFFFAOYSA-N
MW184.63 g/mol
LogP1.92
Rot. Bonds2

About N-[2-(aminomethyl)phenyl]carbamoyl chloride

N-[2-(aminomethyl)phenyl]carbamoyl chloride (PubChem CID 142823786) has the molecular formula C8H9ClN2O and a molecular weight of 184.63 g/mol. Its IUPAC name is N-[2-(aminomethyl)phenyl]carbamoyl chloride.

Molecular Properties

Compound NameN-[2-(aminomethyl)phenyl]carbamoyl chloride
PubChem CID142823786
Molecular FormulaC8H9ClN2O
Molecular Weight184.63 g/mol
Exact Mass184.04
IUPAC NameN-[2-(aminomethyl)phenyl]carbamoyl chloride
SMILESNCc1ccccc1NC(=O)Cl
InChIInChI=1S/C8H9ClN2O/c9-8(12)11-7-4-2-1-3-6(7)5-10/h1-4H,5,10H2,(H,11,12)
InChIKeyMBOJXXDPSZZTOK-UHFFFAOYSA-N
XLogP1.92
TPSA55.12 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds2
Heavy Atoms12
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500184.63
LogP ≤ 51.92
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}

Analyze N-[2-(aminomethyl)phenyl]carbamoyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of N-[2-(aminomethyl)phenyl]carbamoyl chloride?
The IUPAC name of N-[2-(aminomethyl)phenyl]carbamoyl chloride (CID 142823786) is N-[2-(aminomethyl)phenyl]carbamoyl chloride.
What is the SMILES notation for N-[2-(aminomethyl)phenyl]carbamoyl chloride?
The canonical SMILES for N-[2-(aminomethyl)phenyl]carbamoyl chloride is NCc1ccccc1NC(=O)Cl.
What is the InChIKey of N-[2-(aminomethyl)phenyl]carbamoyl chloride?
The InChIKey is MBOJXXDPSZZTOK-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9ClN2O/c9-8(12)11-7-4-2-1-3-6(7)5-10/h1-4H,5,10H2,(H,11,12).
What are the key properties of N-[2-(aminomethyl)phenyl]carbamoyl chloride?
N-[2-(aminomethyl)phenyl]carbamoyl chloride has a molecular weight of 184.63 g/mol, XLogP of 1.92, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(aminomethyl)phenyl]carbamoyl chloride is sourced from PubChem (CID 142823786), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).