C14H13Cl2N3O — CID 64895840
1-[2-(aminomethyl)phenyl]-3-(2,5-dichlorophenyl)urea (PubChem CID 64895840) has the molecular formula C14H13Cl2N3O and a molecular weight of 310.18 g/mol. Its IUPAC name is 1-[2-(aminomethyl)phenyl]-3-(2,5-dichlorophenyl)urea.
| Compound Name | 1-[2-(aminomethyl)phenyl]-3-(2,5-dichlorophenyl)urea |
|---|---|
| PubChem CID | 64895840 |
| Molecular Formula | C14H13Cl2N3O |
| Molecular Weight | 310.18 g/mol |
| Exact Mass | 309.04 |
| IUPAC Name | 1-[2-(aminomethyl)phenyl]-3-(2,5-dichlorophenyl)urea |
| SMILES | NCc1ccccc1NC(=O)Nc1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C14H13Cl2N3O/c15-10-5-6-11(16)13(7-10)19-14(20)18-12-4-2-1-3-9(12)8-17/h1-7H,8,17H2,(H2,18,19,20) |
| InChIKey | QMCGHQSNHDAIKZ-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.18 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |