C22H28N4O4 — CID 25032062
N-[4-[2-[(2-aminoacetyl)amino]phenyl]phenyl]-N'-hydroxyoctanediamide (PubChem CID 25032062) has the molecular formula C22H28N4O4 and a molecular weight of 412.49 g/mol. Its IUPAC name is N-[4-[2-[(2-aminoacetyl)amino]phenyl]phenyl]-N'-hydroxyoctanediamide.
| Compound Name | N-[4-[2-[(2-aminoacetyl)amino]phenyl]phenyl]-N'-hydroxyoctanediamide |
|---|---|
| PubChem CID | 25032062 |
| Molecular Formula | C22H28N4O4 |
| Molecular Weight | 412.49 g/mol |
| Exact Mass | 412.21 |
| IUPAC Name | N-[4-[2-[(2-aminoacetyl)amino]phenyl]phenyl]-N'-hydroxyoctanediamide |
| SMILES | NCC(=O)Nc1ccccc1-c1ccc(NC(=O)CCCCCCC(=O)NO)cc1 |
| InChI | InChI=1S/C22H28N4O4/c23-15-22(29)25-19-8-6-5-7-18(19)16-11-13-17(14-12-16)24-20(27)9-3-1-2-4-10-21(28)26-30/h5-8,11-14,30H,1-4,9-10,15,23H2,(H,24,27)(H,25,29)(H,26,28) |
| InChIKey | KRHTTZGDEYILMI-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 133.55 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.49 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|