C19H22ClF3N2O — CID 119813719
7-amino-N-[2-(3,4,5-trifluorophenyl)phenyl]heptanamide;hydrochloride (PubChem CID 119813719) has the molecular formula C19H22ClF3N2O and a molecular weight of 386.85 g/mol. Its IUPAC name is 7-amino-N-[2-(3,4,5-trifluorophenyl)phenyl]heptanamide;hydrochloride.
| Compound Name | 7-amino-N-[2-(3,4,5-trifluorophenyl)phenyl]heptanamide;hydrochloride |
|---|---|
| PubChem CID | 119813719 |
| Molecular Formula | C19H22ClF3N2O |
| Molecular Weight | 386.85 g/mol |
| Exact Mass | 386.14 |
| IUPAC Name | 7-amino-N-[2-(3,4,5-trifluorophenyl)phenyl]heptanamide;hydrochloride |
| SMILES | Cl.NCCCCCCC(=O)Nc1ccccc1-c1cc(F)c(F)c(F)c1 |
| InChI | InChI=1S/C19H21F3N2O.ClH/c20-15-11-13(12-16(21)19(15)22)14-7-4-5-8-17(14)24-18(25)9-3-1-2-6-10-23;/h4-5,7-8,11-12H,1-3,6,9-10,23H2,(H,24,25);1H |
| InChIKey | DAUKBINOZTZZCX-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.85 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|