C36H39N3O3 — CID 102081724
N-[2-[3,5-bis[2-(butanoylamino)phenyl]phenyl]phenyl]butanamide (PubChem CID 102081724) has the molecular formula C36H39N3O3 and a molecular weight of 561.73 g/mol. Its IUPAC name is N-[2-[3,5-bis[2-(butanoylamino)phenyl]phenyl]phenyl]butanamide.
| Compound Name | N-[2-[3,5-bis[2-(butanoylamino)phenyl]phenyl]phenyl]butanamide |
|---|---|
| PubChem CID | 102081724 |
| Molecular Formula | C36H39N3O3 |
| Molecular Weight | 561.73 g/mol |
| Exact Mass | 561.30 |
| IUPAC Name | N-[2-[3,5-bis[2-(butanoylamino)phenyl]phenyl]phenyl]butanamide |
| SMILES | CCCC(=O)Nc1ccccc1-c1cc(-c2ccccc2NC(=O)CCC)cc(-c2ccccc2NC(=O)CCC)c1 |
| InChI | InChI=1S/C36H39N3O3/c1-4-13-34(40)37-31-19-10-7-16-28(31)25-22-26(29-17-8-11-20-32(29)38-35(41)14-5-2)24-27(23-25)30-18-9-12-21-33(30)39-36(42)15-6-3/h7-12,16-24H,4-6,13-15H2,1-3H3,(H,37,40)(H,38,41)(H,39,42) |
| InChIKey | LHFQLRZRNYIRBY-UHFFFAOYSA-N |
| XLogP | 8.90 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.73 |
| LogP ≤ 5 | 8.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |