C31H30N2O2 — CID 112830357
3-methyl-N,N'-bis(2-phenylphenyl)hexanediamide (PubChem CID 112830357) has the molecular formula C31H30N2O2 and a molecular weight of 462.59 g/mol. Its IUPAC name is 3-methyl-N,N'-bis(2-phenylphenyl)hexanediamide.
| Compound Name | 3-methyl-N,N'-bis(2-phenylphenyl)hexanediamide |
|---|---|
| PubChem CID | 112830357 |
| Molecular Formula | C31H30N2O2 |
| Molecular Weight | 462.59 g/mol |
| Exact Mass | 462.23 |
| IUPAC Name | 3-methyl-N,N'-bis(2-phenylphenyl)hexanediamide |
| SMILES | CC(CCC(=O)Nc1ccccc1-c1ccccc1)CC(=O)Nc1ccccc1-c1ccccc1 |
| InChI | InChI=1S/C31H30N2O2/c1-23(22-31(35)33-29-19-11-9-17-27(29)25-14-6-3-7-15-25)20-21-30(34)32-28-18-10-8-16-26(28)24-12-4-2-5-13-24/h2-19,23H,20-22H2,1H3,(H,32,34)(H,33,35) |
| InChIKey | WCSSPXRKPFUELV-UHFFFAOYSA-N |
| XLogP | 7.40 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.59 |
| LogP ≤ 5 | 7.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |