C19H24N2O — CID 2112768
2-[[(2R)-pentan-2-yl]amino]-N-(2-phenylphenyl)acetamide (PubChem CID 2112768) has the molecular formula C19H24N2O and a molecular weight of 296.41 g/mol. Its IUPAC name is 2-[[(2R)-pentan-2-yl]amino]-N-(2-phenylphenyl)acetamide.
| Compound Name | 2-[[(2R)-pentan-2-yl]amino]-N-(2-phenylphenyl)acetamide |
|---|---|
| PubChem CID | 2112768 |
| Molecular Formula | C19H24N2O |
| Molecular Weight | 296.41 g/mol |
| Exact Mass | 296.19 |
| IUPAC Name | 2-[[(2R)-pentan-2-yl]amino]-N-(2-phenylphenyl)acetamide |
| SMILES | CCC[C@@H](C)NCC(=O)Nc1ccccc1-c1ccccc1 |
| InChI | InChI=1S/C19H24N2O/c1-3-9-15(2)20-14-19(22)21-18-13-8-7-12-17(18)16-10-5-4-6-11-16/h4-8,10-13,15,20H,3,9,14H2,1-2H3,(H,21,22)/t15-/m1/s1 |
| InChIKey | DXOPOLOLCPXACJ-OAHLLOKOSA-N |
| XLogP | 4.07 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.41 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |