C20H24N2O3 — CID 122099893
(2S,3S)-3-methyl-2-[[2-oxo-2-(2-phenylanilino)ethyl]amino]pentanoic acid (PubChem CID 122099893) has the molecular formula C20H24N2O3 and a molecular weight of 340.42 g/mol. Its IUPAC name is (2S,3S)-3-methyl-2-[[2-oxo-2-(2-phenylanilino)ethyl]amino]pentanoic acid.
| Compound Name | (2S,3S)-3-methyl-2-[[2-oxo-2-(2-phenylanilino)ethyl]amino]pentanoic acid |
|---|---|
| PubChem CID | 122099893 |
| Molecular Formula | C20H24N2O3 |
| Molecular Weight | 340.42 g/mol |
| Exact Mass | 340.18 |
| IUPAC Name | (2S,3S)-3-methyl-2-[[2-oxo-2-(2-phenylanilino)ethyl]amino]pentanoic acid |
| SMILES | CC[C@H](C)[C@H](NCC(=O)Nc1ccccc1-c1ccccc1)C(=O)O |
| InChI | InChI=1S/C20H24N2O3/c1-3-14(2)19(20(24)25)21-13-18(23)22-17-12-8-7-11-16(17)15-9-5-4-6-10-15/h4-12,14,19,21H,3,13H2,1-2H3,(H,22,23)(H,24,25)/t14-,19-/m0/s1 |
| InChIKey | FSKZGPKGWHQWSL-LIRRHRJNSA-N |
| XLogP | 3.38 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.42 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |