C26H24N2O — CID 9397796
2-[[(1R)-1-naphthalen-1-ylethyl]amino]-N-(2-phenylphenyl)acetamide (PubChem CID 9397796) has the molecular formula C26H24N2O and a molecular weight of 380.49 g/mol. Its IUPAC name is 2-[[(1R)-1-naphthalen-1-ylethyl]amino]-N-(2-phenylphenyl)acetamide.
| Compound Name | 2-[[(1R)-1-naphthalen-1-ylethyl]amino]-N-(2-phenylphenyl)acetamide |
|---|---|
| PubChem CID | 9397796 |
| Molecular Formula | C26H24N2O |
| Molecular Weight | 380.49 g/mol |
| Exact Mass | 380.19 |
| IUPAC Name | 2-[[(1R)-1-naphthalen-1-ylethyl]amino]-N-(2-phenylphenyl)acetamide |
| SMILES | C[C@@H](NCC(=O)Nc1ccccc1-c1ccccc1)c1cccc2ccccc12 |
| InChI | InChI=1S/C26H24N2O/c1-19(22-16-9-13-20-12-5-6-14-23(20)22)27-18-26(29)28-25-17-8-7-15-24(25)21-10-3-2-4-11-21/h2-17,19,27H,18H2,1H3,(H,28,29)/t19-/m1/s1 |
| InChIKey | CAESWHWBDPUSRC-LJQANCHMSA-N |
| XLogP | 5.80 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.49 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |