C21H22N2O — CID 9396912
N-(3-methylphenyl)-2-[[(1S)-1-naphthalen-1-ylethyl]amino]acetamide (PubChem CID 9396912) has the molecular formula C21H22N2O and a molecular weight of 318.42 g/mol. Its IUPAC name is N-(3-methylphenyl)-2-[[(1S)-1-naphthalen-1-ylethyl]amino]acetamide.
| Compound Name | N-(3-methylphenyl)-2-[[(1S)-1-naphthalen-1-ylethyl]amino]acetamide |
|---|---|
| PubChem CID | 9396912 |
| Molecular Formula | C21H22N2O |
| Molecular Weight | 318.42 g/mol |
| Exact Mass | 318.17 |
| IUPAC Name | N-(3-methylphenyl)-2-[[(1S)-1-naphthalen-1-ylethyl]amino]acetamide |
| SMILES | Cc1cccc(NC(=O)CN[C@@H](C)c2cccc3ccccc23)c1 |
| InChI | InChI=1S/C21H22N2O/c1-15-7-5-10-18(13-15)23-21(24)14-22-16(2)19-12-6-9-17-8-3-4-11-20(17)19/h3-13,16,22H,14H2,1-2H3,(H,23,24)/t16-/m0/s1 |
| InChIKey | WNPCXZMJSDEWOC-INIZCTEOSA-N |
| XLogP | 4.44 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.42 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |