C22H24N2O — CID 9397239
N-(2,4-dimethylphenyl)-2-[[(1R)-1-naphthalen-1-ylethyl]amino]acetamide (PubChem CID 9397239) has the molecular formula C22H24N2O and a molecular weight of 332.45 g/mol. Its IUPAC name is N-(2,4-dimethylphenyl)-2-[[(1R)-1-naphthalen-1-ylethyl]amino]acetamide.
| Compound Name | N-(2,4-dimethylphenyl)-2-[[(1R)-1-naphthalen-1-ylethyl]amino]acetamide |
|---|---|
| PubChem CID | 9397239 |
| Molecular Formula | C22H24N2O |
| Molecular Weight | 332.45 g/mol |
| Exact Mass | 332.19 |
| IUPAC Name | N-(2,4-dimethylphenyl)-2-[[(1R)-1-naphthalen-1-ylethyl]amino]acetamide |
| SMILES | Cc1ccc(NC(=O)CN[C@H](C)c2cccc3ccccc23)c(C)c1 |
| InChI | InChI=1S/C22H24N2O/c1-15-11-12-21(16(2)13-15)24-22(25)14-23-17(3)19-10-6-8-18-7-4-5-9-20(18)19/h4-13,17,23H,14H2,1-3H3,(H,24,25)/t17-/m1/s1 |
| InChIKey | JPQVAIYGCRVEIY-QGZVFWFLSA-N |
| XLogP | 4.75 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.45 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |