C21H21N3O2 — CID 9397279
4-[[2-[[(1S)-1-naphthalen-1-ylethyl]amino]acetyl]amino]benzamide (PubChem CID 9397279) has the molecular formula C21H21N3O2 and a molecular weight of 347.42 g/mol. Its IUPAC name is 4-[[2-[[(1S)-1-naphthalen-1-ylethyl]amino]acetyl]amino]benzamide.
| Compound Name | 4-[[2-[[(1S)-1-naphthalen-1-ylethyl]amino]acetyl]amino]benzamide |
|---|---|
| PubChem CID | 9397279 |
| Molecular Formula | C21H21N3O2 |
| Molecular Weight | 347.42 g/mol |
| Exact Mass | 347.16 |
| IUPAC Name | 4-[[2-[[(1S)-1-naphthalen-1-ylethyl]amino]acetyl]amino]benzamide |
| SMILES | C[C@H](NCC(=O)Nc1ccc(C(N)=O)cc1)c1cccc2ccccc12 |
| InChI | InChI=1S/C21H21N3O2/c1-14(18-8-4-6-15-5-2-3-7-19(15)18)23-13-20(25)24-17-11-9-16(10-12-17)21(22)26/h2-12,14,23H,13H2,1H3,(H2,22,26)(H,24,25)/t14-/m0/s1 |
| InChIKey | HWAKCOATOSGALK-AWEZNQCLSA-N |
| XLogP | 3.23 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.42 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |