C14H17Cl3N2O3 — CID 122099830
(2S,3S)-3-methyl-2-[[2-oxo-2-(2,4,5-trichloroanilino)ethyl]amino]pentanoic acid (PubChem CID 122099830) has the molecular formula C14H17Cl3N2O3 and a molecular weight of 367.66 g/mol. Its IUPAC name is (2S,3S)-3-methyl-2-[[2-oxo-2-(2,4,5-trichloroanilino)ethyl]amino]pentanoic acid.
| Compound Name | (2S,3S)-3-methyl-2-[[2-oxo-2-(2,4,5-trichloroanilino)ethyl]amino]pentanoic acid |
|---|---|
| PubChem CID | 122099830 |
| Molecular Formula | C14H17Cl3N2O3 |
| Molecular Weight | 367.66 g/mol |
| Exact Mass | 366.03 |
| IUPAC Name | (2S,3S)-3-methyl-2-[[2-oxo-2-(2,4,5-trichloroanilino)ethyl]amino]pentanoic acid |
| SMILES | CC[C@H](C)[C@H](NCC(=O)Nc1cc(Cl)c(Cl)cc1Cl)C(=O)O |
| InChI | InChI=1S/C14H17Cl3N2O3/c1-3-7(2)13(14(21)22)18-6-12(20)19-11-5-9(16)8(15)4-10(11)17/h4-5,7,13,18H,3,6H2,1-2H3,(H,19,20)(H,21,22)/t7-,13-/m0/s1 |
| InChIKey | FUYGNNQGCXOGKZ-CPFSXVBKSA-N |
| XLogP | 3.67 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.66 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|