C18H18N2O2 — CID 4089024
N-[2-(5-methyl-1,3-benzoxazol-2-yl)phenyl]butanamide (PubChem CID 4089024) has the molecular formula C18H18N2O2 and a molecular weight of 294.35 g/mol. Its IUPAC name is N-[2-(5-methyl-1,3-benzoxazol-2-yl)phenyl]butanamide.
| Compound Name | N-[2-(5-methyl-1,3-benzoxazol-2-yl)phenyl]butanamide |
|---|---|
| PubChem CID | 4089024 |
| Molecular Formula | C18H18N2O2 |
| Molecular Weight | 294.35 g/mol |
| Exact Mass | 294.14 |
| IUPAC Name | N-[2-(5-methyl-1,3-benzoxazol-2-yl)phenyl]butanamide |
| SMILES | CCCC(=O)Nc1ccccc1-c1nc2cc(C)ccc2o1 |
| InChI | InChI=1S/C18H18N2O2/c1-3-6-17(21)19-14-8-5-4-7-13(14)18-20-15-11-12(2)9-10-16(15)22-18/h4-5,7-11H,3,6H2,1-2H3,(H,19,21) |
| InChIKey | BJGCZGMBHJBQER-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.35 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |