C25H19N3O4 — CID 4625308
3-(1,3-dioxoisoindol-2-yl)-N-[2-(5-methyl-1,3-benzoxazol-2-yl)phenyl]propanamide (PubChem CID 4625308) has the molecular formula C25H19N3O4 and a molecular weight of 425.44 g/mol. Its IUPAC name is 3-(1,3-dioxoisoindol-2-yl)-N-[2-(5-methyl-1,3-benzoxazol-2-yl)phenyl]propanamide.
| Compound Name | 3-(1,3-dioxoisoindol-2-yl)-N-[2-(5-methyl-1,3-benzoxazol-2-yl)phenyl]propanamide |
|---|---|
| PubChem CID | 4625308 |
| Molecular Formula | C25H19N3O4 |
| Molecular Weight | 425.44 g/mol |
| Exact Mass | 425.14 |
| IUPAC Name | 3-(1,3-dioxoisoindol-2-yl)-N-[2-(5-methyl-1,3-benzoxazol-2-yl)phenyl]propanamide |
| SMILES | Cc1ccc2oc(-c3ccccc3NC(=O)CCN3C(=O)c4ccccc4C3=O)nc2c1 |
| InChI | InChI=1S/C25H19N3O4/c1-15-10-11-21-20(14-15)27-23(32-21)18-8-4-5-9-19(18)26-22(29)12-13-28-24(30)16-6-2-3-7-17(16)25(28)31/h2-11,14H,12-13H2,1H3,(H,26,29) |
| InChIKey | GKSZDKJIZCZVHD-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 92.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.44 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|