4-[2-(5-methyl-1,3-benzoxazol-2-yl)anilino]-4-oxobutanoic acid

C18H16N2O4 — CID 3530071

IUPAC4-[2-(5-methyl-1,3-benzoxazol-2-yl)anilino]-4-oxobutanoic acid
SMILESCc1ccc2oc(-c3ccccc3NC(=O)CCC(=O)O)nc2c1
InChIInChI=1S/C18H16N2O4/c1-11-6-7-15-14(10-11)20-18(24-15)12-4-2-3-5-13(12)19-16(21)8-9-17(22)23/h2-7,10H,8-9H2,1H3,(H,19,21)(H,22,23)
InChIKeyHMMXYPAQKAVOIP-UHFFFAOYSA-N
MW324.34 g/mol
LogP3.61
Rot. Bonds5

About 4-[2-(5-methyl-1,3-benzoxazol-2-yl)anilino]-4-oxobutanoic acid

4-[2-(5-methyl-1,3-benzoxazol-2-yl)anilino]-4-oxobutanoic acid (PubChem CID 3530071) has the molecular formula C18H16N2O4 and a molecular weight of 324.34 g/mol. Its IUPAC name is 4-[2-(5-methyl-1,3-benzoxazol-2-yl)anilino]-4-oxobutanoic acid.

Molecular Properties

Compound Name4-[2-(5-methyl-1,3-benzoxazol-2-yl)anilino]-4-oxobutanoic acid
PubChem CID3530071
Molecular FormulaC18H16N2O4
Molecular Weight324.34 g/mol
Exact Mass324.11
IUPAC Name4-[2-(5-methyl-1,3-benzoxazol-2-yl)anilino]-4-oxobutanoic acid
SMILESCc1ccc2oc(-c3ccccc3NC(=O)CCC(=O)O)nc2c1
InChIInChI=1S/C18H16N2O4/c1-11-6-7-15-14(10-11)20-18(24-15)12-4-2-3-5-13(12)19-16(21)8-9-17(22)23/h2-7,10H,8-9H2,1H3,(H,19,21)(H,22,23)
InChIKeyHMMXYPAQKAVOIP-UHFFFAOYSA-N
XLogP3.61
TPSA92.43 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds5
Heavy Atoms24
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500324.34
LogP ≤ 53.61
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze 4-[2-(5-methyl-1,3-benzoxazol-2-yl)anilino]-4-oxobutanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-[2-(5-methyl-1,3-benzoxazol-2-yl)anilino]-4-oxobutanoic acid?
The IUPAC name of 4-[2-(5-methyl-1,3-benzoxazol-2-yl)anilino]-4-oxobutanoic acid (CID 3530071) is 4-[2-(5-methyl-1,3-benzoxazol-2-yl)anilino]-4-oxobutanoic acid.
What is the SMILES notation for 4-[2-(5-methyl-1,3-benzoxazol-2-yl)anilino]-4-oxobutanoic acid?
The canonical SMILES for 4-[2-(5-methyl-1,3-benzoxazol-2-yl)anilino]-4-oxobutanoic acid is Cc1ccc2oc(-c3ccccc3NC(=O)CCC(=O)O)nc2c1.
What is the InChIKey of 4-[2-(5-methyl-1,3-benzoxazol-2-yl)anilino]-4-oxobutanoic acid?
The InChIKey is HMMXYPAQKAVOIP-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H16N2O4/c1-11-6-7-15-14(10-11)20-18(24-15)12-4-2-3-5-13(12)19-16(21)8-9-17(22)23/h2-7,10H,8-9H2,1H3,(H,19,21)(H,22,23).
What are the key properties of 4-[2-(5-methyl-1,3-benzoxazol-2-yl)anilino]-4-oxobutanoic acid?
4-[2-(5-methyl-1,3-benzoxazol-2-yl)anilino]-4-oxobutanoic acid has a molecular weight of 324.34 g/mol, XLogP of 3.61, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2-(5-methyl-1,3-benzoxazol-2-yl)anilino]-4-oxobutanoic acid is sourced from PubChem (CID 3530071), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).