C19H26ClN3O3S — CID 119753331
7-amino-N-[2-(benzenesulfonamido)phenyl]heptanamide;hydrochloride (PubChem CID 119753331) has the molecular formula C19H26ClN3O3S and a molecular weight of 411.96 g/mol. Its IUPAC name is 7-amino-N-[2-(benzenesulfonamido)phenyl]heptanamide;hydrochloride.
| Compound Name | 7-amino-N-[2-(benzenesulfonamido)phenyl]heptanamide;hydrochloride |
|---|---|
| PubChem CID | 119753331 |
| Molecular Formula | C19H26ClN3O3S |
| Molecular Weight | 411.96 g/mol |
| Exact Mass | 411.14 |
| IUPAC Name | 7-amino-N-[2-(benzenesulfonamido)phenyl]heptanamide;hydrochloride |
| SMILES | Cl.NCCCCCCC(=O)Nc1ccccc1NS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C19H25N3O3S.ClH/c20-15-9-2-1-6-14-19(23)21-17-12-7-8-13-18(17)22-26(24,25)16-10-4-3-5-11-16;/h3-5,7-8,10-13,22H,1-2,6,9,14-15,20H2,(H,21,23);1H |
| InChIKey | ZPXCDPSNWAHTJC-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.96 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|