C18H21NO4S — CID 135365962
6-(benzenesulfonyl)-N-(2-hydroxyphenyl)hexanamide (PubChem CID 135365962) has the molecular formula C18H21NO4S and a molecular weight of 347.44 g/mol. Its IUPAC name is 6-(benzenesulfonyl)-N-(2-hydroxyphenyl)hexanamide.
| Compound Name | 6-(benzenesulfonyl)-N-(2-hydroxyphenyl)hexanamide |
|---|---|
| PubChem CID | 135365962 |
| Molecular Formula | C18H21NO4S |
| Molecular Weight | 347.44 g/mol |
| Exact Mass | 347.12 |
| IUPAC Name | 6-(benzenesulfonyl)-N-(2-hydroxyphenyl)hexanamide |
| SMILES | O=C(CCCCCS(=O)(=O)c1ccccc1)Nc1ccccc1O |
| InChI | InChI=1S/C18H21NO4S/c20-17-12-7-6-11-16(17)19-18(21)13-5-2-8-14-24(22,23)15-9-3-1-4-10-15/h1,3-4,6-7,9-12,20H,2,5,8,13-14H2,(H,19,21) |
| InChIKey | PMTCNPVQLOBDRO-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.44 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|